| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
Pyridine trifluoroacetate manufacturers
|
| | Pyridine trifluoroacetate Basic information |
| Product Name: | Pyridine trifluoroacetate | | Synonyms: | TRIFLUOROACETIC ACID PYRIDINE SALT;PYRIDINE TRIFLUOROACETATE;Pyridine trifluoroacetate salt;trifluoroacetоpyridine;PRIDINIUM TRIFLUOROACETATE;2,2,2-trifluoroethanoic acid;Pyridinium trifluoroacetate,Trifluoroacetic acid pyridine salt;Pyridine trifluoroacetate 98% | | CAS: | 464-05-1 | | MF: | C7H6F3NO2 | | MW: | 193.12 | | EINECS: | 207-345-8 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 464-05-1.mol |  |
| | Pyridine trifluoroacetate Chemical Properties |
| Melting point | 83-86 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | water: soluble5%, clear, colorless | | form | Solid | | color | White to Off-White | | Water Solubility | water: soluble 5%, clear, colorless | | BRN | 3735993 | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H5N.C2HF3O2/c1-2-4-6-5-3-1;3-2(4,5)1(6)7/h1-5H;(H,6,7) | | InChIKey | NRTYMEPCRDJMPZ-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(=O)O.C1=CC=NC=C1 | | CAS DataBase Reference | 464-05-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Pyridine trifluoroacetate Usage And Synthesis |
| Uses | Pyridine Trifluoroacetate may be used as a catalyst, coupling agent or reacting solvent. | | General Description | Pyridine trifluoroacetate forms reversed micelles with alkylammonium carboxylates in benzene. |
| | Pyridine trifluoroacetate Preparation Products And Raw materials |
|