|
|
| | Chenodeoxycholic acid sodium Basic information |
| Product Name: | Chenodeoxycholic acid sodium | | Synonyms: | 3-alpha,7-alpha-dihydroxy-5-beta-cholan-24-oicacimonosodiumsalt;Sodium chenodeoxycholate,3α,7α-Dihydroxy-5β-cholanic acid, 5β-Cholanic acid-3α,7α-diol, Chenodeoxycholic acid sodium salt, Chenodesoxycholic acid, Chenodiol;3α,7α-Dihydroxy-5β-cholanic acid, 5β-Cholanic acid-3α,7α-diol, Chenodeoxycholic acid sodium salt, Chenodesoxycholic acid, Chenodiol;3α,7α-Dihydroxy-5β-cholan-24-oic acid sodium salt;Chenodiol
Chenodesoxycholic acid;cholan-24-oicacid,3,7-dihydroxy-,monosodiumsalt,(3-alpha,5-beta,7-alpha);sodiumchenodeoxycholate;sodiumchenodesoxycholate | | CAS: | 2646-38-0 | | MF: | C24H41NaO4 | | MW: | 416.58 | | EINECS: | | | Product Categories: | 2646-38-0 | | Mol File: | 2646-38-0.mol |  |
| | Chenodeoxycholic acid sodium Chemical Properties |
| Melting point | 298 °C(dec.) | | storage temp. | +15C to +30C | | solubility | DMF: 3 mg/mL; DMSO: 10 mg/mL; Ethanol: 1 mg/mL; PBS (pH 7.2): 0.5 mg/mL | | form | A solid | | color | White to off-white | | Water Solubility | water: 20mg/mL aqueous buffer: soluble | | Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS | | InChIKey | WANBNZVOEKGHSS-OHXJQDLJNA-N | | SMILES | C[C@]12CC[C@]3([H])[C@]4(CC[C@@H](O)C[C@@]4([H])C[C@@H](O)[C@@]3([H])[C@]1([H])CC[C@]2([H])[C@H](C)CCC(=O)O)C.[NaH] |&1:1,4,6,9,12,15,17,19,23,25,r| |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | RTECS | FZ2231000 | | HS Code | 29181990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Repr. 2 |
| | Chenodeoxycholic acid sodium Usage And Synthesis |
| Chemical Properties | CHENODEOXYCHOLIC ACID SODIUM is Solid | | Uses | CHENODEOXYCHOLIC ACID SODIUM is a bile acid used in rat hepatocyte studies | | Uses | Chenodeoxycholic Acid, Sodium Salt is a bile acid used in rat hepatocyte studies. It can be used in biological study of interaction between dietary bioactive peptides of short length and bile salts in submicellar or micellar state. | | Biological Activity | Bile Salt |
| | Chenodeoxycholic acid sodium Preparation Products And Raw materials |
|