| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:N,N-Diethyl-1H-indole-1-carboxamide
CAS:119668-50-7
Purity:98% Remarks:B71257
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:N,N-Diethyl-1H-indole-1-carboxamide
CAS:119668-50-7
Purity:97% Package:5G Remarks:663786-5G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:N,N-Diethyl-1H-indole-1-carboxamide 97%
CAS:119668-50-7
Purity:97% Package:25g;5g Remarks:NULL
|
|
| | N N-DIETHYL-1H-INDOLE-1-CARBOXAMIDE 97 Basic information |
| | N N-DIETHYL-1H-INDOLE-1-CARBOXAMIDE 97 Chemical Properties |
| Boiling point | 140-147 °C/0.8 mmHg | | density | 1.089 g/mL at 25 °C | | refractive index | n20/D 1.575 | | Fp | 110 °C | | InChI | 1S/C13H16N2O/c1-3-14(4-2)13(16)15-10-9-11-7-5-6-8-12(11)15/h5-10H,3-4H2,1-2H3 | | InChIKey | DNEILLNCDATSFX-UHFFFAOYSA-N | | SMILES | CCN(CC)C(=O)n1ccc2ccccc12 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N N-DIETHYL-1H-INDOLE-1-CARBOXAMIDE 97 Usage And Synthesis |
| Uses | reactant in preparation of substituted indoles via ortho-metalation and Suzuki-Miyaura cross coupling. | | Uses | - reactant in preparation of substituted indoles via ortho-metalation and Suzuki-Miyaura cross coupling
|
| | N N-DIETHYL-1H-INDOLE-1-CARBOXAMIDE 97 Preparation Products And Raw materials |
|