|
|
| | VAL-THR Basic information |
| | VAL-THR Chemical Properties |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | InChI | 1S/C9H18N2O4/c1-4(2)6(10)8(13)11-7(5(3)12)9(14)15/h4-7,12H,10H2,1-3H3,(H,11,13)(H,14,15) | | InChIKey | GVRKWABULJAONN-UHFFFAOYSA-N | | SMILES | CC(C)C(N)C(=O)NC(C(C)O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | VAL-THR Usage And Synthesis |
| Uses | (2S,3R)-2-((S)-2-Amino-3-methylbutanamido)-3-hydroxybutanoic acid is a threonine derivative[1]. | | Definition | ChEBI: Val-Thr is a dipeptide obtained by formal condensation of the carboxy group of L-valine with the amino group of L-threonine. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | VAL-THR Preparation Products And Raw materials |
|