|
|
| | 4-Pyrimidinamine, 2-methyl- (9CI) Basic information |
| Product Name: | 4-Pyrimidinamine, 2-methyl- (9CI) | | Synonyms: | 4-Pyrimidinamine, 2-methyl- (9CI);2-methylpyrimidin-4-amine;4-Amino-2-methylpyrimidine;2-Methyl-4-pyrimidinamine;4-PyriMidinaMine,2-Methyl;2-Methylpyrimidin-4-amine 98%;184573;2-Methyl-4-Pyrimidinamine(WX606010) | | CAS: | 74-69-1 | | MF: | C5H7N3 | | MW: | 109.13 | | EINECS: | 205-525-8 | | Product Categories: | PYRIMIDINE | | Mol File: | 74-69-1.mol |  |
| | 4-Pyrimidinamine, 2-methyl- (9CI) Chemical Properties |
| Melting point | 204-205℃ | | Boiling point | 222℃ | | density | 1.155 | | Fp | 111℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 5.99±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H7N3/c1-4-7-3-2-5(6)8-4/h2-3H,1H3,(H2,6,7,8) | | InChIKey | GKVDLTTVBNOGNJ-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC(N)=N1 |
| | 4-Pyrimidinamine, 2-methyl- (9CI) Usage And Synthesis |
| Synthesis Reference(s) | Tetrahedron Letters, 7, p. 4325, 1966 DOI: 10.1016/0005-2760(66)90119-6 | | Synthesis | The general procedure for the synthesis of 2-methyl-4-aminopyrimidine from trimethyl orthoacetate and 3-methoxyacrylonitrile was as follows: in a 10 mL stainless steel pressure-resistant reactor, 1.0 g (12 mmol) of 3-methoxyacrylonitrile, 3.9 g (32 mmol) of trimethyl orthoacetate, and 4.0 g (56 mmol) of 24 wt% ammonia-methanol solution were added in sequence. The reaction mixture was stirred at 130°C for 8 hours. After completion of the reaction, 20 mL of hexane was added to the reaction mixture, stirred thoroughly and filtered to afford 0.94 g (isolated yield: 72%) of the target product 2-methyl-4-aminopyrimidine as yellow crystals. 2-methyl-4-aminopyrimidine was characterized physically as follows: 1H-NMR (DMSO-d6, δ/ppm): 2.29 (3H, s), 6.22 (1H, dd, J = 5.9), 4.0 g (56 mmol) of 24 wt% ammonia-methanol solution. dd, J = 5.9, 0.5 Hz), 6.69 (2H, brs), 7.94 (1H, d, J = 5.9 Hz); CI-MS (m/e): 109 (M + 1). | | References | [1] Patent: US2008/45712, 2008, A1. Location in patent: Page/Page column 3-4 |
| | 4-Pyrimidinamine, 2-methyl- (9CI) Preparation Products And Raw materials |
|