| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Tetra-n-butylammonium tetraphenylborate manufacturers
|
| | Tetra-n-butylammonium tetraphenylborate Basic information |
| Product Name: | Tetra-n-butylammonium tetraphenylborate | | Synonyms: | Tetra-n-butylammonium tetraphenylborate, 99+%;Tetrabutylammonium tetraphenylborate puriss., electrochemical grade, >=99.0% (NT);N,N,N-Tributyl-1-Butanaminium tetraphenylborate(1-);Tetrabutylammonium tetraphenylborate 99%;TETRAPHENYLBORON TETRABUTYLAMMONIUM;TETRABUTYLAMMONIUM TETRAPHENYLBORATE;ammonium,tetrabutyl-,tetraphenylborate(1-);borate(1-),tetraphenyl-,N,N,N-tributyl-1-butanaminium | | CAS: | 15522-59-5 | | MF: | C40H56BN | | MW: | 561.71 | | EINECS: | 239-562-9 | | Product Categories: | Ammonium Polyhalides, etc. (Quaternary);B (Classes of Boron Compounds);Quaternary Ammonium Compounds;Tetraphenylborates | | Mol File: | 15522-59-5.mol |  |
| | Tetra-n-butylammonium tetraphenylborate Chemical Properties |
| Melting point | 230-236 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | acetonitrile: 0.1 g/mL, clear, colorless | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble in pyridine, acetone, water. | | Sensitive | Hygroscopic | | BRN | 3857215 | | Stability: | Stable. Incompatible with strong oxidizing agents. Hygroscopic. | | InChIKey | ZHCCBGAUZWZGQV-UHFFFAOYSA-N | | SMILES | CCCC[N+](CCCC)(CCCC)CCCC.c1ccc(cc1)[B-](c2ccccc2)(c3ccccc3)c4ccccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-9 | | HS Code | 2923.90.0100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetra-n-butylammonium tetraphenylborate Usage And Synthesis |
| Chemical Properties | white crystals or powder | | Uses | Tetrabutylammonium tetraphenylborate (CAS# 15522-59-5) is an organic electrolyte, and an electrotunable compound, allowing for its use in the preparation of interesting materials such as electrotunable nanoplasmonic liquid mirrors. | | General Description | Visit our Sensor Applications portal to learn more. |
| | Tetra-n-butylammonium tetraphenylborate Preparation Products And Raw materials |
|