3-Methyl-5-pinacolatoboryl-indazole manufacturers
|
| | 3-Methyl-5-pinacolatoboryl-indazole Basic information |
| Product Name: | 3-Methyl-5-pinacolatoboryl-indazole | | Synonyms: | 3-METHYL-5-PINALATOBORNYL-INDAZOLE;3-METHYL-5-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-1H-INDAZOLE;3-Methyl-1H-indazole-5-bonic acid pinacol ester;3-Methylindazole-5-boronic acid pinacol ester;3-Methyl-5-(tetraMethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole;1H-Indazole, 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-;3-hydroxy-2,3-dimethylbutan-2-yl 3-methyl-1H-indazole-5-carboxylate;3-Methyl-1H-indazole-5-boronic acid pinacol ester | | CAS: | 864771-17-5 | | MF: | C14H19BN2O2 | | MW: | 258.12 | | EINECS: | | | Product Categories: | Indazole;Organic boronic acid | | Mol File: | 864771-17-5.mol |  |
| | 3-Methyl-5-pinacolatoboryl-indazole Chemical Properties |
| Boiling point | 416.7±25.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.40±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C14H19BN2O2/c1-9-11-8-10(6-7-12(11)17-16-9)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3,(H,16,17) | | InChIKey | YTYTZKVFIGWLKK-UHFFFAOYSA-N | | SMILES | Cc1n[nH]c2ccc(cc12)B3OC(C)(C)C(C)(C)O3 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-Methyl-5-pinacolatoboryl-indazole Usage And Synthesis |
| | 3-Methyl-5-pinacolatoboryl-indazole Preparation Products And Raw materials |
|