| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | BAPTA tetraethyl ester Basic information |
| Product Name: | BAPTA tetraethyl ester | | Synonyms: | 1,2-bis(2-aminophenoxy)ethane-n,n,n',n'-tetraacetic acid tetraethyl ester;BAPTA TETRAETHYL ESTER, 98+%;N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(2-ethoxy-2-oxoethyl)glycine diethyl ester;NSC 368732 N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(2-ethoxy-2-oxoethyl)glycine diethyl ester;NSC 368732;CS-964;Glycine, N,N'-[1,2-ethanediylbis(oxy-2,1-phenylene)]bis[N-(2-ethoxy-2-oxoethyl)-, 1,1'-diethyl ester;Ethyl 2-[2-[2-[2-[bis(2-Ethoxy-2-oxoethyl)amino]phenoxy]ethoxy]-N-(2-ethoxy-2-oxoethyl)anilino]acetate | | CAS: | 73630-07-6 | | MF: | C30H40N2O10 | | MW: | 588.65 | | EINECS: | | | Product Categories: | | | Mol File: | 73630-07-6.mol |  |
| | BAPTA tetraethyl ester Chemical Properties |
| Melting point | 98-100°C | | storage temp. | Sealed in dry,Room Temperature | | InChIKey | OLXCPQDFHUCXBA-UHFFFAOYSA-N | | SMILES | C(OC1=CC=CC=C1N(CC(OCC)=O)CC(OCC)=O)COC1=CC=CC=C1N(CC(OCC)=O)CC(OCC)=O | | CAS DataBase Reference | 73630-07-6 |
| Provider | Language |
|
ALFA
| English |
| | BAPTA tetraethyl ester Usage And Synthesis |
| Uses | Bapta tetraethyl ester is a kind of biochemical reagent. |
| | BAPTA tetraethyl ester Preparation Products And Raw materials |
|