|
|
| | 5-Cyanooxindole Basic information |
| Product Name: | 5-Cyanooxindole | | Synonyms: | 5-Cyanoindolin-2-one;5-Cyano-2-oxindole;2-Oxo-2,3-dihydro-1H-indole-5-carbonitrile;5-Cyano-1,3-dihydroindol-2-one;5-Cyanoox-2-indole;1H-Indole-5-carbonitrile, 2,3-dihydro-2-oxo-;5-CYANOOXINDOLE in stock Factory;2-oxo-1,3-dihydroindole-5-carbonitrile | | CAS: | 61394-50-1 | | MF: | C9H6N2O | | MW: | 158.16 | | EINECS: | | | Product Categories: | API intermediates;blocks;IndolesOxindoles | | Mol File: | 61394-50-1.mol |  |
| | 5-Cyanooxindole Chemical Properties |
| Melting point | 236-239°C | | Boiling point | 389.7±42.0 °C(Predicted) | | density | 1.33 | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.84±0.20(Predicted) | | form | solid | | color | Off White | | InChI | InChI=1S/C9H6N2O/c10-5-6-1-2-8-7(3-6)4-9(12)11-8/h1-3H,4H2,(H,11,12) | | InChIKey | NZOSLRYUVHMXTQ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(C#N)C=C2)CC1=O |
| | 5-Cyanooxindole Usage And Synthesis |
| Uses | 2-Oxoindoline-5-carbonitrile is used as a reactant in the preparation of indolinone-based kinase inhibitors. |
| | 5-Cyanooxindole Preparation Products And Raw materials |
|