- EP-A（LB）
-
-
2026-09-30
- CAS:171596-27-3
- Min. Order: 5g
- Purity: 95%+
- Supply Ability: 100kg+
- cis-Tadalafil
-
- $141.00
-
2026-08-08
- CAS:171596-27-3
- Purity: 99.89%
- Supply Ability: 10g
- cis-Tadalafil
-
-
2026-06-30
- CAS:171596-27-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | cis-Tadalafil Basic information |
| Product Name: | cis-Tadalafil | | Synonyms: | cis-Tadalafil;6R,12S-Tadalafil;(6R,12aS)-;Tadalafil IMpurity: IMpurity H;Tadalafil EP IMpurity A (cis-tadalafil);Pyrazino[1',2':1,6]pyrido[3,4-b]indole-1,4-dione,6-(1,3- benzodioxol-5-yl)-2,3,6,7,12, 12a-hexahydro-2-Methyl-,(6R, 12aS)-;(6R,12aS)-6-(1,3-benzodioxol-5-yl)-2-Methyl-2,3,6,7,12,12a-hexahydropyrazino[1′,2′:1,6]pyrido[3,4-b]indole-1,4-dione;Tadanafil EP or USP impurity A | | CAS: | 171596-27-3 | | MF: | C22H19N3O4 | | MW: | 389.4 | | EINECS: | | | Product Categories: | Chiral Reagents;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 171596-27-3.mol |  |
| | cis-Tadalafil Chemical Properties |
| Melting point | 285-287 °C(Solv: toluene (108-88-3)) | | Boiling point | 679.1±55.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly, Methanol (Slightly) | | form | Solid | | pka | 16.68±0.40(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C22H19N3O4/c1-24-10-19(26)25-16(22(24)27)9-14-13-4-2-3-5-15(13)23-20(14)21(25)12-6-7-17-18(8-12)29-11-28-17/h2-8,16,21,23H,9-11H2,1H3/t16-,21+/m0/s1 | | InChIKey | WOXKDUGGOYFFRN-HRAATJIYSA-N | | SMILES | N1C2=C(C=CC=C2)C2C[C@@]3([H])C(=O)N(C)CC(=O)N3[C@H](C3=CC=C4OCOC4=C3)C1=2 |
| | cis-Tadalafil Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | The (6R)-cis-enantiomer of Tadalafil (T004500). Tadalafil Impurity (6R,12aS) |
| | cis-Tadalafil Preparation Products And Raw materials |
| Raw materials | methyl L-tryptophanate-->Chloropretadalafil-->(1R,3S)-1-(1,3-Benzodioxol-5-yl)-2-(2-chloroacetyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic Acid Methyl Ester-->(1R,3S)-1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic Acid Methyl Ester-->Tadalafil-->(1R,3R)-Methyl-1,2,3,4-tetrahydro-1-(3,4-methylenedioxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate-->Methylamine-->Formaldehyde-->N-[(tert-Butoxy)carbonyl]-L-tryptophan-->Piperonyl aldehyde |
|