|
|
| | n-Undecane-d24 Basic information |
| | n-Undecane-d24 Chemical Properties |
| storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly), Hexanes (Slightly) | | form | Oil | | color | Colourless | | Stability: | Volatile | | InChI | 1S/C11H24/c1-3-5-7-9-11-10-8-6-4-2/h3-11H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2 | | InChIKey | RSJKGSCJYJTIGS-XMTORAMYSA-N | | SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H] |
| WGK Germany | WGK 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Asp. Tox. 1 Flam. Liq. 3 |
| | n-Undecane-d24 Usage And Synthesis |
| Uses | n-Undecane-d24 (CAS# 164858-54-2) is a useful isotopically labeled research compound. |
| | n-Undecane-d24 Preparation Products And Raw materials |
|