| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- Vitamin K3-D8
-
-
2026-05-11
- CAS:478171-80-1
- Purity:
- Supply Ability: 10g
|
| | 2-Methyl-1,4-naphthoquinone-d8 Basic information |
| | 2-Methyl-1,4-naphthoquinone-d8 Chemical Properties |
| Melting point | 105-107 °C(lit.) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Yellow | | InChI | 1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3/i1D3,2D,3D,4D,5D,6D | | InChIKey | MJVAVZPDRWSRRC-JGUCLWPXSA-N | | SMILES | [2H]c1c([2H])c([2H])c2C(=O)C(=C([2H])C(=O)c2c1[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 58-27-5 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2936290000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 2-Methyl-1,4-naphthoquinone-d8 Usage And Synthesis |
| Chemical Properties | 2-METHYL-1,4-NAPHTHOQUINONE-D8 is Brown Solid | | Uses | Precursor to verious types of Vitamin K. Used as a micronutrient for livestock and pet foods. | | Uses | Vitamin K3-d8 (or menadione-d8) is a deuterated analog of vitamin K3. It is used as an internal standard for the quantification of vitamin K3 concentration in dietary supplements, fortified foods or within a complex biological matrix. |
| | 2-Methyl-1,4-naphthoquinone-d8 Preparation Products And Raw materials |
|