|
|
| | Di-tert-butylmethylphosphonium tetrafluoroborate Basic information |
| Product Name: | Di-tert-butylmethylphosphonium tetrafluoroborate | | Synonyms: | Di-tert-B-butylmethylphosphonium tetrafluoroborate, 99%;Di-tert-butylmethylphosphonium tetrafluoroborate,99%;Bis(1,1-dimethylethyl)(methyl)phosphine tetrafluoroborate;Di-tert-butyl(methyl)phosphonium Tetrafluoroborate;Di-tert-butylmethylphosphine tetrafluoroborate;Di-tert-butyl(methyl)phosphoniumTetrafluoroborate>;ditert-butyl(methyl)phosphanium;Phosphine, bis(1,1-dimethylethyl)methyl-, tetrafluoroborate(1-) | | CAS: | 479094-62-7 | | MF: | C9H22BF4P | | MW: | 248.05 | | EINECS: | | | Product Categories: | | | Mol File: | 479094-62-7.mol |  |
| | Di-tert-butylmethylphosphonium tetrafluoroborate Chemical Properties |
| Melting point | >230 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | PH | 1.79 (1% in solution) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H21P.BF4/c1-8(2,3)10(7)9(4,5)6;2-1(3,4)5/h1-7H3;/q;-1/p+1 | | InChIKey | BRDLRXCAHKUWJS-UHFFFAOYSA-O | | SMILES | [PH+](C)(C(C)(C)C)C(C)(C)C.[B-](F)(F)(F)F |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Di-tert-butylmethylphosphonium tetrafluoroborate Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Di-tert-butyl(methyl)phosphonium tetrafluoroborate may be used in the preparation of a precursor for nantenine analogs bearing a C4 phenyl substituent, which shows an affinity for 5-HT2B receptor. It may also be used in the palladium-catalyzed borylation of primary alkyl electrophiles (bromides, iodides or tosylates) using bis(pinacolato)diboron or bis(neopentyl glycolato)diboron as the boron source. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand
reaction type: Cross Couplings |
| | Di-tert-butylmethylphosphonium tetrafluoroborate Preparation Products And Raw materials |
|