| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| Product Name: | 2,1-Benzisoxazole | | Synonyms: | benz(c)isoxazole;2,1-Benzisoxazole,99%;2,1-BenzisoxazoleAnthranil;2,1-benzoxazole;Anthranil >BenzisoxazoleQ: What is
Benzisoxazole Q: What is the CAS Number of
Benzisoxazole Q: What is the storage condition of
Benzisoxazole Q: What are the applications of
Benzisoxazole;2,1-Benzoisoxazole;ANTHRANIL | | CAS: | 271-58-9 | | MF: | C7H5NO | | MW: | 119.12 | | EINECS: | 205-980-5 | | Product Categories: | | | Mol File: | 271-58-9.mol |  |
| | 2,1-Benzisoxazole Chemical Properties |
| Melting point | <-18.15°C | | Boiling point | 101-102 °C15 mm Hg(lit.) | | density | 1.183 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.584(lit.) | | Fp | 201 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | pka | -2.03±0.30(Predicted) | | color | Clear yellow to brown-red | | InChI | InChI=1S/C7H5NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5H | | InChIKey | FZKCAHQKNJXICB-UHFFFAOYSA-N | | SMILES | N1=C2C(C=CC=C2)=CO1 | | CAS DataBase Reference | 271-58-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25-25-24 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,1-Benzisoxazole Usage And Synthesis |
| Application | Benzisoxazole (benzoylimine) is often used as the parent nucleus of other compounds; for example, 3-methylbenzisoxazole (benzoylimine) can be used as a pharmaceutical synthesis intermediate. | | Chemical Properties | CLEAR YELLOW TO BROWN-RED LIQUID | | Uses | Anthranil undergoes thermal decomposition during single pulse shock-tube experiments to form aniline and cyclopentadiene carbonitrile. Surface-enhanced Raman spectrum of anthranil in activated silver colloid has been studied. | | Definition | ChEBI: A benzoxazole in which the benzene ring is fused to a 1,2-oxazole ring across positions 3 and 4. | | General Description | Anthranil undergoes thermal decomposition during single pulse shock-tube experiments to form aniline and cyclopentadiene carbonitrile. Surface-enhanced Raman spectrum of anthranil in activated silver colloid has been studied. |
| | 2,1-Benzisoxazole Preparation Products And Raw materials |
|