|
|
| | 1-fluoro-7-chlorodibenzofuran Basic information |
| Product Name: | 1-fluoro-7-chlorodibenzofuran | | Synonyms: | 1-fluoro-7-chlorodibenzofuran;7-chloro-1-fluorodibenzo[b,d]furan;7-chloro-1-fluorodib enzo[ b,dJ]furan;7-chloro-1-fluorodibenzo[d,d]furan;Dibenzofuran, 7-chloro-1-fluoro- | | CAS: | 2244899-56-5 | | MF: | C12H6ClFO | | MW: | 220.63 | | EINECS: | | | Product Categories: | | | Mol File: | 2244899-56-5.mol |  |
| | 1-fluoro-7-chlorodibenzofuran Chemical Properties |
| Boiling point | 326.6±22.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | color | white powder | | InChI | InChI=1S/C12H6ClFO/c13-7-4-5-8-11(6-7)15-10-3-1-2-9(14)12(8)10/h1-6H | | InChIKey | XOYOPIIAJCYLDA-UHFFFAOYSA-N | | SMILES | O1C2=CC(Cl)=CC=C2C2=C(F)C=CC=C12 |
| | 1-fluoro-7-chlorodibenzofuran Usage And Synthesis |
| Uses | 1-fluoro-7-chlorodibenzofuran is an important OLED material and electronic chemical material. | | Definition | 1-fluoro-7-chlorodibenzofuran is a fluorinated and chlorinated derivative of dibenzofuran. Dibenzofuran is a tricyclic heterocyclic compound with a 14π electron ring system comprised of two benzene rings fused with 2,3- and 4,5-positions of the furan ring. The structural unit of Dibenzofuran is present as a substructure in various naturally occurring compounds such as morphine and codeine. |
| | 1-fluoro-7-chlorodibenzofuran Preparation Products And Raw materials |
|