| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
010-82848833 400-666-7788 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:sec-Butyl Butyrate
CAS:819-97-6
Purity:98.0%(GC) Package:5ML
|
|
| | sec-butyl butyrate Basic information |
| Product Name: | sec-butyl butyrate | | Synonyms: | sec-butyl butyrate;Butanoic acid, 1-methylpropyl ester;Butyric acid 1-methylpropyl ester;Butyric acid sec-butyl ester;sec-Butyl Butyrate;sec-Butyl Butyrate > | | CAS: | 819-97-6 | | MF: | C8H16O2 | | MW: | 144.21 | | EINECS: | 212-465-9 | | Product Categories: | | | Mol File: | 819-97-6.mol |  |
| | sec-butyl butyrate Chemical Properties |
| Melting point | -88.07°C (estimate) | | Boiling point | 152°C(lit.) | | density | 0.8836 (estimate) | | refractive index | 1.4000-1.4040 | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C8H16O2/c1-4-6-8(9)10-7(3)5-2/h7H,4-6H2,1-3H3 | | InChIKey | QJHDFBAAFGELLO-UHFFFAOYSA-N | | SMILES | C(OC(C)CC)(=O)CCC | | LogP | 2.667 (est) |
| RIDADR | 3272 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2915907098 |
| | sec-butyl butyrate Usage And Synthesis |
| Definition | ChEBI: A butyrate ester obtained by the formal condensation of butyric acid with butan-2-ol. |
| | sec-butyl butyrate Preparation Products And Raw materials |
|