- (S)-HOMO-BETA-VALINE
-
- $1.00 / 1KG
-
2019-07-06
- CAS:40469-85-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,100kg
|
| | (S)-HOMO-BETA-VALINE
Basic information |
| Product Name: | (S)-HOMO-BETA-VALINE
| | Synonyms: | REF DUPL: (S)-beta-homovaline;L-β-Hoval-OH;Pentanoic acid, 3-amino-4-methyl-, (3S)-;(S)-HOMO-BETA-VALINE;3-Amino-4-Mthylpentanoic acid;D-beta-Leucine | | CAS: | 40469-85-0 | | MF: | C6H13NO2 | | MW: | 131.17 | | EINECS: | | | Product Categories: | | | Mol File: | 40469-85-0.mol |  |
| | (S)-HOMO-BETA-VALINE
Chemical Properties |
| Melting point | 202-210℃ (decomposition) | | Boiling point | 232.0±23.0 °C(Predicted) | | density | 1.035±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.81±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H13NO2/c1-4(2)5(7)3-6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 | | InChIKey | GLUJNGJDHCTUJY-YFKPBYRVSA-N | | SMILES | C(O)(=O)C[C@H](N)C(C)C |
| | (S)-HOMO-BETA-VALINE
Usage And Synthesis |
| Definition | ChEBI: (3S)-beta-leucine is the (3S)-beta-isomer of leucine. It is an enantiomer of a (3R)-beta-leucine. |
| | (S)-HOMO-BETA-VALINE
Preparation Products And Raw materials |
|