| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,4-Difluorobenzenesulfonyl chloride Basic information |
| | 2,4-Difluorobenzenesulfonyl chloride Chemical Properties |
| Boiling point | 101-102 °C (1 mmHg) | | density | 1.581 g/mL at 25 °C(lit.) | | refractive index | 1.5187 | | Fp | >110°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Clear colorless to light yellow | | Sensitive | Moisture Sensitive | | BRN | 2970373 | | InChI | 1S/C6H3ClF2O2S/c7-12(10,11)6-2-1-4(8)3-5(6)9/h1-3H | | InChIKey | FJSAJUXIHJIAMD-UHFFFAOYSA-N | | SMILES | Fc1ccc(c(F)c1)S(Cl)(=O)=O | | CAS DataBase Reference | 13918-92-8(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 45-36/37/39-26 | | RIDADR | 3265 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 2,4-Difluorobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 2,4-Difluorobenzenesulfonyl chloride may be used in the preparation of 2,4-difluoro-N,N-dimethylbenzenesulfonamide, a precursor for poly(aryl ether sulfonamide)s.
It may be used in the preparation of the following benzenesulfonamide quinoline derivatives with potent anti-HIV-1 (human immunodeficiency virus type 1) activity:
- 2,4-difluoro-N-methyl-N-(quinolin-8-yl)benzenesulfonamide
- N-ethyl-2,4-difluoro-N-(quinolin-8-yl)benzenesulfonamide
- 2,4-difluoro-N-(quinolin-8-yl)benzenesulfonamide
| | General Description | 2,4-Difluorobenzenesulfonyl chloride is an aryl sulfonyl chloride derivative. |
| | 2,4-Difluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|