- Dimethyloxazolidine
-
- $1.00 / 1kg
-
2026-03-20
- CAS:51200-87-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
|
| | 4,4-DIMETHYLOXAZOLIDINE Basic information |
| Product Name: | 4,4-DIMETHYLOXAZOLIDINE | | Synonyms: | 4,4-dimethyl;4,4-dimethyl-oxazolidin;4,4-dimethyloxazolidine(impurity;4,4-Dimethyloxazolidine solution;dimethyloxazolidine;notcleared;notclearedasinert);oxazolidinea | | CAS: | 51200-87-4 | | MF: | C5H11NO | | MW: | 101.15 | | EINECS: | 257-048-2 | | Product Categories: | | | Mol File: | 51200-87-4.mol |  |
| | 4,4-DIMETHYLOXAZOLIDINE Chemical Properties |
| Boiling point | 189.55°C (rough estimate) | | density | 0.942 g/mL at 25 °C | | refractive index | n20/D 1.432 | | Fp | 120 °F | | storage temp. | 2-8°C, protect from light | | pka | 8.41±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | Cosmetics Ingredients Functions | PRESERVATIVE | | InChI | InChI=1S/C5H11NO/c1-5(2)3-7-4-6-5/h6H,3-4H2,1-2H3 | | InChIKey | GUQMDNQYMMRJPY-UHFFFAOYSA-N | | SMILES | O1CC(C)(C)NC1 | | LogP | 1.11 at 25℃ | | EPA Substance Registry System | 4,4-Dimethyloxazolidine (51200-87-4) |
| | 4,4-DIMETHYLOXAZOLIDINE Usage And Synthesis |
| Uses | 4,4-Dimethyl-oxazolidine is a preservative for latex paints and emulsions and for cooling fluids (component in Bioban CS 1135). | | Uses | Oxazolidine A is a reagent that is used inantimicrobial mixtures. It is particular useful for fighting Aspergillus brasiliensis. | | Toxics Screening Level | The initial threshold screening level (ITSL) for dimethyloxazolidine is 1 μg/m3 (based on an annual
averaging time). |
| | 4,4-DIMETHYLOXAZOLIDINE Preparation Products And Raw materials |
|