| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
|
| | (S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine Basic information |
| Product Name: | (S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine | | Synonyms: | (S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine;S-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine;S-2-[[[(1,1-DIMETHYLETHYL)DIMETHYLSILYL]OXY]DIPHENYLMETHYL]-PYRROLIDINE;(S)-()-α,α-Diphenyl-2-pyrrolidineMethanol tert-butyldiMethylsilyl ether >=97% (HPLC);2-(S)-[(DIPHENYL)(t-BUTYLDIMETHYLSILOXY)METHYL]PYRROLIDINE;(S)-2-[(tert-ButyldiMethylsiloxy)diphenylMethyl]pyrrolidine;(S)-(?)-α,α-Diphenyl-2-pyrrolidinemethanol tert-butyldimethylsilyl ether;(S)-(?)-α,α-Diphenylprolinol tert-butyldimethylsilyl ether | | CAS: | 864466-71-7 | | MF: | C23H33NOSi | | MW: | 367.6 | | EINECS: | | | Product Categories: | | | Mol File: | 864466-71-7.mol | ![(S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine Structure](CAS/GIF/864466-71-7.gif) |
| | (S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine Chemical Properties |
| Melting point | 71-73°C | | Boiling point | 445.2±35.0 °C(Predicted) | | density | 0.998±0.06 g/cm3(Predicted) | | Fp | >110°C (>230°F) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 10.12±0.10(Predicted) | | Appearance | White to off-white Solid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 10368174 | | InChI | 1S/C23H33NOSi/c1-22(2,3)26(4,5)25-23(21-17-12-18-24-21,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16,21,24H,12,17-18H2,1-5H3/t21-/m0/s1 | | InChIKey | YJFSFDYMOMREQP-NRFANRHFSA-N | | SMILES | CC(C)(C)[Si](C)(C)OC([C@@H]1CCCN1)(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine Usage And Synthesis |
| | (S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine Preparation Products And Raw materials |
|