|
|
| | (1R,3S)-1β,3β-Cyclohexanediamine Basic information |
| Product Name: | (1R,3S)-1β,3β-Cyclohexanediamine | | Synonyms: | (1R,3S)-1,3-Cyclohexanediamine;(1R,3S)-1β,3β-Cyclohexanediamine;(1S)-1α,3α-Cyclohexanediamine;cis-1,3-Cyclohexanediamine;cis-cyclohexane-1,3-diamine;[(1R,3S)-3-AZANIUMYLCYCLOHEXYL]AZANIUM;(1R,3S)-Cyclohexane-1,3-diamine;cis-1,3-Cyclohexanediamine> | | CAS: | 26772-34-9 | | MF: | C6H14N2 | | MW: | 114.19 | | EINECS: | | | Product Categories: | | | Mol File: | 26772-34-9.mol |  |
| | (1R,3S)-1β,3β-Cyclohexanediamine Chemical Properties |
| Boiling point | 198°C(lit.) | | density | 0.9515 g/cm3 | | refractive index | 1.4890-1.4930 | | storage temp. | 2-8°C, protect from light | | pka | 10.70±0.70(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1/C6H14N2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,7-8H2/t5-,6+ | | InChIKey | GEQHKFFSPGPGLN-OLQVQODUNA-N | | SMILES | [C@@H]1(N)CCC[C@H](N)C1 |&1:0,5,r| |
| RIDADR | 2735 | | HS Code | 2921.30.5000 | | HazardClass | 8 | | PackingGroup | III |
| | (1R,3S)-1β,3β-Cyclohexanediamine Usage And Synthesis |
| | (1R,3S)-1β,3β-Cyclohexanediamine Preparation Products And Raw materials |
|