| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(-)-1-(9-Fluorenyl)ethyl chloroformate, 0.5 w/v % solution in acetone (ca 18mM)
CAS:154479-90-0
Package:10ML
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(?)-1-(9-Fluorenyl)ethyl chloroforMate solution
CAS:154479-90-0
Purity:18 MM in acetone, for chiral derivatization Package:1ML
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(-)-1-(9-Fluorenyl)ethyl chloroformate solution
CAS:154479-90-0
Purity:18 mM in acetone, for chiral derivatization Package:1ML Remarks:338710-1ML
|
|
| | (+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE Basic information |
| Product Name: | (+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE | | Synonyms: | (+)-FLEC(TM);(-)-FLEC;(+)-FLEC;(-)-FLEC(R);(+)-FLEC(R);(-)-1-(9-Fluorenyl)ethyl chloroformate(-)-Flec;(-)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE;(+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE | | CAS: | 154479-90-0 | | MF: | C16H13ClO2 | | MW: | 272.73 | | EINECS: | | | Product Categories: | | | Mol File: | 154479-90-0.mol |  |
| | (+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE Chemical Properties |
| Melting point | 94°C | | Boiling point | 56°C/760mmHg | | density | 0.792 g/mL at 20 °C | | vapor density | 2 (vs air) | | vapor pressure | 180 mm Hg ( 20 °C) | | refractive index | n20/D 1.3602 | | Fp | 1 °F | | storage temp. | 2-8°C | | InChI | 1S/C16H13ClO2/c1-10(19-16(17)18)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15H,1H3 | | InChIKey | SFRVOKMRHPQYGE-UHFFFAOYSA-N | | SMILES | CC(OC(Cl)=O)C1c2ccccc2-c3ccccc13 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 9-16-26 | | RIDADR | UN 1090 3/PG 2 | | WGK Germany | 2 | | F | 10-21 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | (+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | (+)-1-(9-Fluorenyl)ethyl Chloroformate is an analytical reagent for direct and indirect chiral separation of amino acids by capillary electrophoresis. | | Uses | (-)-1-(9-Fluorenyl)ethyl Chloroformate is an analytical reagent for direct and indirect chiral separation of amino acids by capillary electrophoresis. | | General Description | (-)-1-(9-Fluorenyl)ethyl chloroformate is mostly used as an in-capillary derivatization agent for the separation of amino acid (AA) derivatives by micellar electrokinetic chromatography (MEKC). |
| | (+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE Preparation Products And Raw materials |
|