| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- Tafluprost Ethyl Amide
-
-
2026-09-14
- CAS:1185851-52-8
- Min. Order: 2Kg/Bag
- Purity: 99% up, High Density
- Supply Ability: 20 tons
|
| | Tafluprost ethyl amide Basic information |
| Product Name: | Tafluprost ethyl amide | | Synonyms: | Tafluprost ethyl amide;(Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]-N-ethylhept-5-enamide;5-Heptenamide, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-N-ethyl-, (5Z)-;Tafluprost ethyl amide impurity;1185851-52-8 Tafluprost ethyl amide;Latanoprost Impurity 18;Tofacitinib Impurity 175;Tafluprost IImpurity 7 | | CAS: | 1185851-52-8 | | MF: | C24H33F2NO4 | | MW: | 437.52 | | EINECS: | | | Product Categories: | | | Mol File: | 1185851-52-8.mol |  |
| | Tafluprost ethyl amide Chemical Properties |
| Boiling point | 609.3±55.0 °C(Predicted) | | density | 1.191±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:30.0(Max Conc. mg/mL);68.57(Max Conc. mM)
DMF:30.0(Max Conc. mg/mL);68.57(Max Conc. mM)
Ethanol:30.0(Max Conc. mg/mL);68.57(Max Conc. mM) | | form | Viscous Liquid | | pka | 14.48±0.70(Predicted) | | color | Colorless to light yellow | | Cosmetics Ingredients Functions | HAIR CONDITIONING
NAIL CONDITIONING | | InChIKey | VJZKLIPANASSBD-MSHHKXPZSA-N | | SMILES | C(NCC)(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1/C=C/C(F)(F)COC1=CC=CC=C1 |
| | Tafluprost ethyl amide Usage And Synthesis |
| Uses | Tafluprost Ethyl Amide can be useful in the determination of prostaglandin analogs in cosmetic products by high performance liquid chromatography with tandem mass spectrometry. |
| | Tafluprost ethyl amide Preparation Products And Raw materials |
|