1-Adamantaneisocyanide manufacturers
|
| | 1-Adamantaneisocyanide Basic information |
| Product Name: | 1-Adamantaneisocyanide | | Synonyms: | RARECHEM AQ TC 1022;1-ADAMANTYLISONITRILE;AKOS BC-0478;1-adamantyl isocyanide(SALTDATA: FREE);1-Adamantyl isocyanide 95%;1-Isocyanoadamantane>1-Isocyanoadamantane,≥97%(GC);1-ADAMANTYL ISOCYANIDE | | CAS: | 22110-53-8 | | MF: | C11H15N | | MW: | 161.24 | | EINECS: | | | Product Categories: | Aromatic Nitriles | | Mol File: | 22110-53-8.mol |  |
| | 1-Adamantaneisocyanide Chemical Properties |
| Melting point | 175°C | | storage temp. | RT, stored under nitrogen | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C11H15N/c1-12-11-5-8-2-9(6-11)4-10(3-8)7-11/h8-10H,2-7H2/t8-,9+,10-,11- | | InChIKey | RPRJRJNIFAYHRF-BIBSGERRSA-N | | SMILES | [C-]#[N+]C1(C2)C[C@]3([H])C[C@@]2([H])C[C@@](C1)([H])C3 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 22-36 | | WGK Germany | 3 | | HS Code | 29299090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 1-Adamantaneisocyanide Usage And Synthesis |
| | 1-Adamantaneisocyanide Preparation Products And Raw materials |
|