|
|
| | CHROMIUM (III) 2-ETHYLHEXANOATE Basic information |
| Product Name: | CHROMIUM (III) 2-ETHYLHEXANOATE | | Synonyms: | Chromium(III) 2-ethylhexanoate, 50% in 2-ethylhexanoic acid;Chromium(III) 2-ethylhexanoate, 35% in mineral oil;50%in2-ethylhexanoicacid;Chromium octanoate;Chromium(III)2-ethylhexanoate,70%inmineralspirits(8-10%Cr);2-ethylhexanoic acid chromium(iii) salt;2-ethyl-hexanoic aci chromium salt;CHROMIUM III 2-ETHYLHEXANOATE, 35% in mineral spirits | | CAS: | 3444-17-5 | | MF: | C8H16CrO2 | | MW: | 196.21 | | EINECS: | 222-357-3 | | Product Categories: | metal carboxylate;Organic-metal salt | | Mol File: | 3444-17-5.mol |  |
| | CHROMIUM (III) 2-ETHYLHEXANOATE Chemical Properties |
| Boiling point | 489.1℃[at 101 325 Pa] | | density | 1,01 g/cm3 | | Fp | 110°C | | form | liquid | | Specific Gravity | 1.01 | | color | green, viscous | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Exposure limits | NIOSH: IDLH 25 mg/m3; TWA 0.5 mg/m3 | | InChI | InChI=1S/C8H16O2.Cr/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); | | InChIKey | NPCUWXDZFXSRLT-UHFFFAOYSA-N | | SMILES | C(CC)(C(=O)O)CCCC.[Cr] | | LogP | 7.64 | | EPA Substance Registry System | Chromium(III) 2-ethylhexanoate (3444-17-5) |
| Provider | Language |
|
ALFA
| English |
| | CHROMIUM (III) 2-ETHYLHEXANOATE Usage And Synthesis |
| Uses | Chromium(III) 2-ethylhexanoate is used in paints, coatings and petrochemical manufacturing. |
| | CHROMIUM (III) 2-ETHYLHEXANOATE Preparation Products And Raw materials |
|