| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2,4,5-Trihydroxy-DL-phenylalanine manufacturers
- 6-Hydroxy-DOPA
-
- $45.00
-
2026-05-11
- CAS:21373-30-8
- Purity: 97.95%
- Supply Ability: 10g
|
| | 2,4,5-Trihydroxy-DL-phenylalanine Basic information |
| Product Name: | 2,4,5-Trihydroxy-DL-phenylalanine | | Synonyms: | 2,4,5-Trihydroxy-DL-phenylalanine, 2,5-Dihydroxy-DL-tyrosine;N,N-Dimethylformamide dimethyl acetal,1,1-Dimethoxy-N,N-dimethylmethylamine, 1,1-Dimethoxytrimethylamine;DL-Tyrosine, 2,5-dihydroxy-;Tyrosine, 2,5-dihydroxy-;6-Hydroxy-DL-DOPA >=98% (TLC), powder;U20S,DNA/RNA Synthesis,effective,ssDNA,6 Hydroxy DOPA,6HydroxyDOPA,Inhibitor,allosteric,inhibit,selective,HCC1937,cancer;2,5-Dihydroxytyrosine;Rac-Levodopa EP Impurity A (Rac-Levodopa USP Related Compound A, 6-Hydroxy DOPA) | | CAS: | 21373-30-8 | | MF: | C9H11NO5 | | MW: | 213.19 | | EINECS: | | | Product Categories: | | | Mol File: | 21373-30-8.mol |  |
| | 2,4,5-Trihydroxy-DL-phenylalanine Chemical Properties |
| Boiling point | 515.2±38.0 °C(Predicted) | | density | 1.606±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | H2O: soluble3mg/mL (Dissolve in oxygen-free boiled water containing 0.1% sodium metabisulfite or other antioxidant. Solutions should be freshly prepared and protected from exposure to light.) | | form | powder | | pka | 2.34±0.25(Predicted) | | color | off-white | | Water Solubility | H2O: 3mg/mL
1 M HCl: 50mg/mL (Solutions should be freshly prepared and protected from exposure to light.) | | BRN | 2860065 | | InChI | 1S/C9H11NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,11-13H,1,10H2,(H,14,15) | | InChIKey | YLKRUSPZOTYMAT-UHFFFAOYSA-N | | SMILES | NC(Cc1cc(O)c(O)cc1O)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,4,5-Trihydroxy-DL-phenylalanine Usage And Synthesis |
| Uses | 6-Hydroxy-DL-DOPA is a catecholamine neurotoxin and endogenous exicitotoxin even at non-NMDA receptors. | | Definition | ChEBI: 6-hydroxydopa is a non-proteinogenic alpha-amino acid. It is functionally related to a dopa. | | Biochem/physiol Actions | Precursor of the catecholaminergic neurotoxin, 6-hydroxydopamine; converted to 6-hydroxydopamine by L-aromatic amino acid decarboxylase. | | storage | Store at -20°C |
| | 2,4,5-Trihydroxy-DL-phenylalanine Preparation Products And Raw materials |
|