|
| 3-(Chloromethyl)-5-methylpyridine Basic information |
| 3-(Chloromethyl)-5-methylpyridine Chemical Properties |
Melting point | 154-157 °C | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | form | Solid | color | Off-White to Pale Beige | InChI | InChI=1S/C7H8ClN/c1-6-2-7(3-8)5-9-4-6/h2,4-5H,3H2,1H3 | InChIKey | DZZYVVUYEDSKBU-UHFFFAOYSA-N | SMILES | C1=NC=C(C)C=C1CCl |
Hazard Codes | Xi | HS Code | 2933399990 |
| 3-(Chloromethyl)-5-methylpyridine Usage And Synthesis |
Uses | 3-Chloromethyl-5-methylpyridine is an intermediate in the synthesis of Rupatadine (R701650). |
| 3-(Chloromethyl)-5-methylpyridine Preparation Products And Raw materials |
|