| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | sericic acid Basic information |
| Product Name: | sericic acid | | Synonyms: | sericic acid;(4S)-2α,3β,19α,23-Tetrahydroxyolean-12-en-28-oic acid | | CAS: | 55306-03-1 | | MF: | C30H48O6 | | MW: | 504.7 | | EINECS: | | | Product Categories: | | | Mol File: | 55306-03-1.mol |  |
| | sericic acid Chemical Properties |
| storage temp. | -20°C | | form | solid | | color | White crystalline | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | IFIQVSCCFRXSJV-GOVAGAJPSA-N | | SMILES | CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2[C@@H]1O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | sericic acid Usage And Synthesis |
| Uses | Sericic acid is an antioxidant, PDE4A inhibitor, antiinflammatory, antifungal, and antibacterial. | | storage | +4°C |
| | sericic acid Preparation Products And Raw materials |
|