- 5-Bromonicotinamide
-
- $1.10 / 1g
-
2025-11-18
- CAS:28733-43-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- 5-Bromonicotinamide
-
- $3.00 / 3KG
-
2019-07-06
- CAS:28733-43-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | 5-Bromonicotinamide Basic information |
| | 5-Bromonicotinamide Chemical Properties |
| Melting point | 219-223 °C | | Boiling point | 315.5±27.0 °C(Predicted) | | density | 1.710±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | pka | 14.21±0.50(Predicted) | | color | Off-white to light pink | | InChI | InChI=1S/C6H5BrN2O/c7-5-1-4(6(8)10)2-9-3-5/h1-3H,(H2,8,10) | | InChIKey | YOQRXZIMSKLRCY-UHFFFAOYSA-N | | SMILES | C1=NC=C(Br)C=C1C(N)=O | | CAS DataBase Reference | 28733-43-9(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | QS4170000 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Bromonicotinamide Usage And Synthesis |
| Chemical Properties | Off-white to light pink powder | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 20, p. 129, 1977 DOI: 10.1021/jm00211a027 |
| | 5-Bromonicotinamide Preparation Products And Raw materials |
|