| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- ETHYL 2-PENTYNOATE
-
-
2025-04-04
- CAS:55314-57-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- ETHYL 2-PENTYNOATE
-
- $7.00
-
2020-02-18
- CAS: 55314-57-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | Ethyl 2-pentynoate Basic information |
| | Ethyl 2-pentynoate Chemical Properties |
| Boiling point | 178-179 °C (lit.) | | density | 0.957 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.439(lit.) | | Fp | 102 °F | | storage temp. | 2-8°C | | Specific Gravity | 0.957 | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Not miscible in water. | | BRN | 1750016 | | InChI | InChI=1S/C7H10O2/c1-3-5-6-7(8)9-4-2/h3-4H2,1-2H3 | | InChIKey | XDPRPKSTFBPPHU-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C#CCC |
| Hazard Codes | Xi | | Risk Statements | 10-43 | | Safety Statements | 16-37/39 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29161900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3
Resp. Sens. 1 |
| | Ethyl 2-pentynoate Usage And Synthesis |
| Uses | Ethyl 2-pentynoate is used as pharmaceutical intermediate. |
| | Ethyl 2-pentynoate Preparation Products And Raw materials |
|