| Company Name: |
Hebei Maipu Technology Co., LTD Gold
|
| Tel: |
0311-13231111190 17734576190 |
| Email: |
1148032505@qq.com |
| Products Intro: |
Product Name:2-PIVALOYLAMINO-6-PICOLINE
CAS:86847-79-2
Purity:98%+ Package:1kg;10kg;25kg
|
|
| | 2-PIVALOYLAMINO-6-PICOLINE Basic information |
| Product Name: | 2-PIVALOYLAMINO-6-PICOLINE | | Synonyms: | 2-PIVALOYLAMINO-6-PICOLINE;2,2-Dimethyl-N-(6-methylpyridin-2-yl)propanamide;N-(6-Methylpyridin-2-yl)pivalaMide;Propanamide, 2,2-dimethyl-N-(6-methyl-2-pyridinyl)-;2-specifically valamino-6-methylpyridine;2,2-DIMETHYL-N-(6-METHYL-PYRIDIN-2-YL)-PROPIONAMIDE | | CAS: | 86847-79-2 | | MF: | C11H16N2O | | MW: | 192.26 | | EINECS: | | | Product Categories: | Pyridine | | Mol File: | 86847-79-2.mol |  |
| | 2-PIVALOYLAMINO-6-PICOLINE Chemical Properties |
| Melting point | 66-68 °C(Solv: hexane (110-54-3)) | | Boiling point | 341.0±22.0 °C(Predicted) | | density | 1.058±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 13.82±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H16N2O/c1-8-6-5-7-9(12-8)13-10(14)11(2,3)4/h5-7H,1-4H3,(H,12,13,14) | | InChIKey | MAZMJMLUKYPLEI-UHFFFAOYSA-N | | SMILES | C(NC1=NC(C)=CC=C1)(=O)C(C)(C)C |
| | 2-PIVALOYLAMINO-6-PICOLINE Usage And Synthesis |
| Uses | 2-Pivaloylamino-6-Picoline is a useful reactant and reagent for the synthesis of different compounds and metal complexes. |
| | 2-PIVALOYLAMINO-6-PICOLINE Preparation Products And Raw materials |
|