4-Chlor-3-nitro-5-sulfobenzoesure manufacturers
|
| | 4-Chlor-3-nitro-5-sulfobenzoesure Basic information |
| Product Name: | 4-Chlor-3-nitro-5-sulfobenzoesure | | Synonyms: | 4-Chlor-3-nitro-5-sulfobenzoesure;4-Chloro-3-nitro-5-sulfobenzoic acid;Benzoic acid, 4-chloro-3-nitro-5-sulfo-;Bumetanide Impurity 13;Bumetanide Impurity 16;4-Chloro-3-nitro-5-sulfobenzoic acid (Bumetanide Impurity);Bumetanil impurity 13;Bumetanide Impurity 04 | | CAS: | 130262-91-8 | | MF: | C7H4ClNO7S | | MW: | 281.63 | | EINECS: | | | Product Categories: | | | Mol File: | 130262-91-8.mol |  |
| | 4-Chlor-3-nitro-5-sulfobenzoesure Chemical Properties |
| density | 1.896 | | InChI | InChI=1S/C7H4ClNO7S/c8-6-4(9(12)13)1-3(7(10)11)2-5(6)17(14,15)16/h1-2H,(H,10,11)(H,14,15,16) | | InChIKey | KYAQAYJIAPXFLP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S(O)(=O)=O)=C(Cl)C([N+]([O-])=O)=C1 |
| | 4-Chlor-3-nitro-5-sulfobenzoesure Usage And Synthesis |
| Uses | 4-Chloro-3-nitro-5-sulfobenzoic acid is an intermediate produced from the allergic reaction to bumetanide. |
| | 4-Chlor-3-nitro-5-sulfobenzoesure Preparation Products And Raw materials |
|