|
|
| | (Dimethylamino)acetaldehyde Dimethyl Acetal Basic information |
| Product Name: | (Dimethylamino)acetaldehyde Dimethyl Acetal | | Synonyms: | N-(2,2-DIMETHOXYETHYL)DIMETHYLAMINE;2,2-dimethoxy-n,n-dimethyl-ethanamin;2,2-Dimethoxy-N,N-dimethylethanamine;Ethanamine, 2,2-dimethoxy-N,N-dimethyl-;DIMETHYLAMINOACETALDEHYDE DIMETHYLACETAL;2,2-DIMETHOXY-N,N-DIMETHYLETHYLAMINE;2,2-Dimethoxy-N,N-dimethylethylamine, 2-(Dimethylamino)-1,1-dimethoxyethane;Dinethylaminoacetaldehydediethylacetal | | CAS: | 38711-20-5 | | MF: | C6H15NO2 | | MW: | 133.19 | | EINECS: | 254-097-1 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted) | | Mol File: | 38711-20-5.mol |  |
| | (Dimethylamino)acetaldehyde Dimethyl Acetal Chemical Properties |
| Boiling point | 64 °C | | density | 0.9 | | refractive index | 1.4060-1.4100 | | Fp | 32°C | | storage temp. | Flammables area | | form | Liquid | | pka | 9.35±0.28(Predicted) | | color | Clear colorless to slightly yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C6H15NO2/c1-7(2)5-6(8-3)9-4/h6H,5H2,1-4H3 | | InChIKey | HUYAEQCJNXODLQ-UHFFFAOYSA-N | | SMILES | C(N(C)C)C(OC)OC | | EPA Substance Registry System | Ethanamine, 2,2-dimethoxy-N,N-dimethyl- (38711-20-5) |
| | (Dimethylamino)acetaldehyde Dimethyl Acetal Usage And Synthesis |
| Description | This acetal derivative, also known as 2,2-dimethoxy-N,N-dimethyl-ethanamine, presents as a colorless to pale-yellow liquid. For best results, store in a tightly closed container in a dry and well-ventilated place. (Dimethylamino)acetaldehyde Dimethyl Acetal is incompatible with strong oxidizing agents as well as strong acids. This chemical is flammable in liquid and vapor forms. It also causes skin irritation, serious eye irritation, and may cause respiratory irritation. | | Chemical Properties | Clear colorless liquid |
| | (Dimethylamino)acetaldehyde Dimethyl Acetal Preparation Products And Raw materials |
|