- 4-Phenylimidazole
-
-
2022-02-21
- CAS:670-95-1
- Min. Order: 1KG
- Purity: 97.3%
- Supply Ability: 100 tons
- 4-PHENYLIMIDAZOLE
-
- $1.00
-
2019-07-06
- CAS:670-95-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 200kg
|
| | 4-Phenylimidazole Basic information |
| | 4-Phenylimidazole Chemical Properties |
| Melting point | 128-131 °C (lit.) | | Boiling point | 252.78°C (rough estimate) | | density | 1.1357 (rough estimate) | | refractive index | 1.6200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | acetone: soluble25mg/mL, clear, colorless to yellow (typical) | | form | powder to crystal | | pka | 13.58±0.10(Predicted) | | color | White to Orange to Green | | BRN | 2969 | | InChI | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H,(H,10,11) | | InChIKey | XHLKOHSAWQPOFO-UHFFFAOYSA-N | | SMILES | C1NC(C2=CC=CC=C2)=CN=1 | | CAS DataBase Reference | 670-95-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Phenylimidazole Usage And Synthesis |
| Chemical Properties | White to beige granular powder | | Uses | 4-Phenylimidazole was used to investigate the protein-ligand interactions in cytochrome P450 from the thermoacidophile Picrophilus torridus. It was used as heme ligand during the crystallization of recombinant human indoleamine 2,3-dioxygenase. It was used in the synthesis of complexes of copper and cobalt. | | Uses | An imidazole derivative as antitermite agent. |
| | 4-Phenylimidazole Preparation Products And Raw materials |
|