| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Perindoprilat LactaM B Basic information |
| Product Name: | Perindoprilat LactaM B | | Synonyms: | Perindoprilat LactaM B;(αS,3S,5aS,9aS,10aR)-Decahydro-3-Methyl-1,4-dioxo-α-propylpyrazino[1,2-a]indole-2(1H)-acetic Acid;[3S-[2(R*),3α,5aβ,9aβ,10aα]]-Decahydro-3-Methyl-1,4-dioxo-α-
propylpyrazino[1,2-a]indole-2(1H)-acetic Acid;10aR-Perindoprilat Diketopiperazine;Perindopril IMpurity-D (EP) (USP RC D);Perindopril EP IMpurity D;Perindopril IMpurity D;Perindopril Related CoMpound D | | CAS: | 130061-28-8 | | MF: | C17H26N2O4 | | MW: | 322.4 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 130061-28-8.mol |  |
| | Perindoprilat LactaM B Chemical Properties |
| Melting point | >182°C (dec.) | | Boiling point | 560.3±50.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.66±0.20(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H26N2O4/c1-3-6-13(17(22)23)18-10(2)15(20)19-12-8-5-4-7-11(12)9-14(19)16(18)21/h10-14H,3-9H2,1-2H3,(H,22,23)/t10-,11-,12-,13-,14+/m0/s1 | | InChIKey | GBVXUKWRYVJUFG-HTVCTNPSSA-N | | SMILES | N21[C@@H]3[C@H](C[C@@H]2C(=O)N([C@H](C1=O)C)[C@@H](CCC)C(=O)O)CCCC3 |
| WGK Germany | WGK 3 | | HS Code | 2933999552 | | Storage Class | 11 - Combustible Solids |
| | Perindoprilat LactaM B Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Perindoprilat Lactam B (Perindopril EP Impurity D) is the active metabolite of Perindopril (P287500) in plasma and urine. |
| | Perindoprilat LactaM B Preparation Products And Raw materials |
|