| | 2-(2-chlorophenyl)cyclohexanone Basic information |
| | 2-(2-chlorophenyl)cyclohexanone Chemical Properties |
| Melting point | 60-62 °C | | Boiling point | 308.8±42.0 °C(Predicted) | | density | 1.165±0.06 g/cm3(Predicted) | | form | powder | | color | white crystalline | | InChI | InChI=1S/C12H13ClO/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1,3,5,7,10H,2,4,6,8H2 | | InChIKey | UOEXWLLNMGAJDD-UHFFFAOYSA-N | | SMILES | C1(=O)CCCCC1C1=CC=CC=C1Cl |
| | 2-(2-chlorophenyl)cyclohexanone Usage And Synthesis |
| Chemical Properties | white crystalline powder. | | Uses | 2-(2-Chlorophenyl)-cyclohexanone is a reactant that is used in the preparation of benzofurans via palladium-phosphine-catalyzed intramolecular enolate O-arylation of α-arylketones. | | Synthesis | To a flame dried flask was added Cs2CO3 (6.5 g, 20 mmol), Pd2(dba)3 (184 mg, 0.2 mmol) and Xantphos (139 mmol, 0.24 mmol). After purging with N2, toluene (10 mL), ketone (15 mmol) and phenyl iodide (1.11 mL, 10 mmol) were added. After stirring overnight at 80 .MALE.C, the mixture was filtered and concentrated in vacuo to afford a residue, which was purified by flash chromatography to provide the desired 2-(2-chlorophenyl)cyclohexanone.
 |
| | 2-(2-chlorophenyl)cyclohexanone Preparation Products And Raw materials |
|