|
|
| | (Dimethylaminomethyl)styrene Basic information |
| Product Name: | (Dimethylaminomethyl)styrene | | Synonyms: | VINYLBENZYLDIMETHYLAMINE;N-(4-VINYLBENZYL)-N,N-DIMETHYL AMINE;N,N-DIMETHYLVINYLBENZYLAMINE;Vinylbenzyldimethylamine,STABILIZED,TECH.,90%;N-(4-Vinylbenzyl)-N,N-dimethylamine, tech., stabilized, 90%;N-(4-Vinylbenzyl)-n,n-dimethylamine,90% tech. stabilized,;N-(4-Vinylbenzyl)-N,N-diMethylaMine, 90%, technical, stabilized;N,N-Dimethyl-1-(4-vinylphenyl)methanamine | | CAS: | 2245-52-5 | | MF: | C11H15N | | MW: | 161.24 | | EINECS: | | | Product Categories: | Chloromethy styrene | | Mol File: | 2245-52-5.mol |  |
| | (Dimethylaminomethyl)styrene Chemical Properties |
| Boiling point | 217.3℃ | | density | 0.937 | | refractive index | 1.5380 | | Fp | 77.3℃ | | storage temp. | Refrigerator (+4°C) | | pka | 8.82±0.28(Predicted) | | form | Liquid | | color | Clear yellow to brown | | InChI | InChI=1S/C11H15N/c1-4-10-5-7-11(8-6-10)9-12(2)3/h4-8H,1,9H2,2-3H3 | | InChIKey | XQBHAZDVLGNSOJ-UHFFFAOYSA-N | | SMILES | C1(CN(C)C)=CC=C(C=C)C=C1 |
| Provider | Language |
|
ACROS
| English |
| | (Dimethylaminomethyl)styrene Usage And Synthesis |
| Chemical Properties | clear yellow to brown liquid |
| | (Dimethylaminomethyl)styrene Preparation Products And Raw materials |
|