| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
- Bromoferrocene
-
-
2025-12-24
- CAS:1273-73-0
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KG
- Bromoferrocene
-
- $3.00
-
2020-01-18
- CAS:1273-73-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg , 5kg, 50kg
|
| | Bromoferrocene Basic information |
| Product Name: | Bromoferrocene | | Synonyms: | (bromocyclopentadienyl)cyclopentadienyl-iron;BROMOFERROCENE;Bromoferrocene,97%;bromocyclopentane:cyclopentane:iron;Bromoferrocene >Bromoferrocene ISO 9001:2015 REACH;Bromoferrocene, 95%, | | CAS: | 1273-73-0 | | MF: | C10H9BrFe10* | | MW: | 264.93 | | EINECS: | | | Product Categories: | metallocene;Ferrocene series | | Mol File: | 1273-73-0.mol |  |
| | Bromoferrocene Chemical Properties |
| Melting point | 31-33°C | | Fp | >110℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | orange | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C5H4Br.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H;1-5H; | | InChIKey | RFYQCXFGACWJED-UHFFFAOYSA-N | | SMILES | [C]1(Br)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,2,3,4,5,6,7,8,9,10| |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | Bromoferrocene Usage And Synthesis |
| Uses | Bromoferrocene is used as pharmaceutical intermediates. | | reaction suitability | core: iron reagent type: catalyst |
| | Bromoferrocene Preparation Products And Raw materials |
|