2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester manufacturers
|
| | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester Basic information |
| Product Name: | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester | | Synonyms: | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester;ETC-1002 intermediate;Pentadecanedioic acid, 2,2,14,14-tetramethyl-8-oxo-, 1,15-diethyl ester;diethyl 2,2,14,14-tetramethyl-;Keto Diethyl Ester Impurity of Bempedoic Acid;Bepidoic acid impurity 6;Buprenorphine Impurity 20;Intermediate of Betamethasone | | CAS: | 738606-43-4 | | MF: | C23H42O5 | | MW: | 398.58 | | EINECS: | | | Product Categories: | | | Mol File: | 738606-43-4.mol |  |
| | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester Chemical Properties |
| Boiling point | 472.7±30.0 °C(Predicted) | | density | 0.966±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to brown Liquid | | InChI | InChI=1S/C23H42O5/c1-7-27-20(25)22(3,4)17-13-9-11-15-19(24)16-12-10-14-18-23(5,6)21(26)28-8-2/h7-18H2,1-6H3 | | InChIKey | LDURYVDWYUCWGK-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C)(C)CCCCCC(=O)CCCCCC(C)(C)C(OCC)=O |
| | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester Usage And Synthesis |
| Uses | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester is an impurity of Bempedoic Acid. |
| | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester Preparation Products And Raw materials |
|