| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,5-Dichloro-4-nitroaniline Basic information |
| Product Name: | 2,5-Dichloro-4-nitroaniline | | Synonyms: | 2,5-dichloro-4-nitro-anilin;2,5-dichloro-4-nitro-benzenamin;Benzenamine,2,5-dichloro-4-nitro-;2,5-Dichloro-4-nitrobenzenamine;TIMTEC-BB SBB003478;2,5-Dichloro-4-nitroaniline,97%;2,5-DICHLO-4-NITROANILINE;2,5-DICHLORO-4-NITROANILINE ISO 9001：2015 REACH | | CAS: | 6627-34-5 | | MF: | C6H4Cl2N2O2 | | MW: | 207.01 | | EINECS: | 229-591-5 | | Product Categories: | Intermediates of Dyes and Pigments;Amines;C2 to C6;Nitrogen Compounds;Building Blocks;Chemical Synthesis;C6;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 6627-34-5.mol |  |
| | 2,5-Dichloro-4-nitroaniline Chemical Properties |
| Melting point | 154-158 °C (lit.) | | Boiling point | 360.98°C (rough estimate) | | density | 1.6257 (rough estimate) | | refractive index | 1.6100 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | pK1:-1.74(+1) (25°C) | | color | Light yellow to Amber to Dark green | | BRN | 2211952 | | InChI | 1S/C6H4Cl2N2O2/c7-3-2-6(10(11)12)4(8)1-5(3)9/h1-2H,9H2 | | InChIKey | JBXZCPXEYAEMJS-UHFFFAOYSA-N | | SMILES | Nc1cc(Cl)c(cc1Cl)[N+]([O-])=O | | CAS DataBase Reference | 6627-34-5(CAS DataBase Reference) | | EPA Substance Registry System | 2,5-Dichloro-4-nitroaniline (6627-34-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | BX2950000 | | TSCA | TSCA listed | | HS Code | 29214200 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 2 Inhalation
Acute Tox. 2 Oral
Aquatic Chronic 2
STOT RE 2 |
| | 2,5-Dichloro-4-nitroaniline Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 2,5-Dichloro-4-nitroaniline may be employed as an indicator for the estimation of acidity of strong acids. | | General Description | 2,5-Dichloro-4-nitroaniline is primary aniline indicator. Its pKa in sulfonate and water are -2.12 and -1.78, respectively. | | Purification Methods | Recrystallise it from EtOH, then sublime it in vacuo.[Beilstein 12 H 735, 12 II 400.] |
| | 2,5-Dichloro-4-nitroaniline Preparation Products And Raw materials |
| Raw materials | 1,4-Benzenediamine, 2,5-dinitro--->N-(2,5-dichloro-4-nitrophenyl)acetamide-->2',5'-Dichloroacetanilide-->1,4-Dichloro-2,5-dinitrobenzene-->Ammonia-->1,4-Dichlorobenzene | | Preparation Products | 1-Iodo-2,4,5-trichlorobenzene-->AMACEL ORANGE 4R |
|