Oseltamivir Impurity 17 manufacturers
- Ent-Oseltamivir
-
- $0.00 / 10mg
-
2025-09-25
- CAS:
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | Oseltamivir Impurity 17 Basic information |
| Product Name: | Oseltamivir Impurity 17 | | Synonyms: | (3S,4S,5R)-ethyl 4-acetamido;(3S, 4S, 5R) - 5-acetylamino-4-amino-3 - (pentane-3-oxy) cyclohexene-1-ethyl formate;Ent-Oseltamivir;(3S,4S,5R)-ethyl 4-acetamido-5-amino;Oseltamivir EP Impurity J HCl(Ent-Oseltamivir HCl);Oseltamivir EP Impurity J（Ent-Oseltamivir）;(3S,4S,5R)-4-acetylamino-5-amino-3-(1-ethylpropoxy)cyclohex-1-enecarboxylicacidethylester;ethyl (3S,4S,5R)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate | | CAS: | 1035895-88-5 | | MF: | C16H28N2O4 | | MW: | 312.4 | | EINECS: | | | Product Categories: | | | Mol File: | 1035895-88-5.mol |  |
| | Oseltamivir Impurity 17 Chemical Properties |
| Boiling point | 473.3±45.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | pka | 14.68±0.70(Predicted) | | InChI | InChI=1S/C16H28N2O4/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19/h9,12-15H,5-8,17H2,1-4H3,(H,18,19)/t13-,14+,15+/m1/s1 | | InChIKey | VSZGPKBBMSAYNT-ILXRZTDVSA-N | | SMILES | C1(C(OCC)=O)C[C@@H](N)[C@H](NC(C)=O)[C@@H](OC(CC)CC)C=1 |
| | Oseltamivir Impurity 17 Usage And Synthesis |
| | Oseltamivir Impurity 17 Preparation Products And Raw materials |
|