|
|
| | 1H,1H,2H,2H-Perfluorohexan-1-ol Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorohexan-1-ol | | Synonyms: | 1,1,2,2-Tetrahydroperfluoro-1-hexanol;3,3,4,4,5,5,6,6,6-nonafluoro-1-hexano;2-(PERFLUOROBUTYL)ETHANOL;3,3,4,4,5,5,6,6,6-NONAFLUORO-1-HEXANOL;3,3,4,4,5,5,6,6,6-Nonafluorohexanol;DAIKIN A-1420;1H,1H,2H,2H-NONAFLUORO-1-HEXANOL;1H,1H,2H,2H-NONAFLUOROHEXAN-1-OL | | CAS: | 2043-47-2 | | MF: | C6H5F9O | | MW: | 264.09 | | EINECS: | 218-050-9 | | Product Categories: | organofluorine compounds;Organics;Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry | | Mol File: | 2043-47-2.mol |  |
| | 1H,1H,2H,2H-Perfluorohexan-1-ol Chemical Properties |
| Boiling point | 140-143 °C (lit.) | | density | 1.59 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.314(lit.) | | Fp | 164 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform, Methanol (Slightly) | | form | liquid | | pka | 14.16±0.10(Predicted) | | color | colorless | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H5F9O/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h16H,1-2H2 | | InChIKey | JCMNMOBHVPONLD-UHFFFAOYSA-N | | SMILES | C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 2043-47-2(CAS DataBase Reference) | | EPA Substance Registry System | 1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro- (2043-47-2) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29055900 |
| | 1H,1H,2H,2H-Perfluorohexan-1-ol Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 1H,1H,2H,2H-Perfluorohexanol is used in the synthesis of polymer coatings with controlled surface topography. As well used in the preparation of star polymers as fluorous nanocapsules for the encapsulation and release of perfluorinated compounds. |
| | 1H,1H,2H,2H-Perfluorohexan-1-ol Preparation Products And Raw materials |
|