- HEXAFLUOROGLUTARIC ACID
-
- $8.00 / 1kg
-
2025-09-25
- CAS:376-73-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | HEXAFLUOROGLUTARIC ACID Basic information |
| Product Name: | HEXAFLUOROGLUTARIC ACID | | Synonyms: | TIMTEC-BB SBB000791;Hexafluoroglutaricacid,min.97%;Hexafluoroglutaric acid 98%;Hexafluoroglutaricacid98%;Hexafluoroglutaric acid, min. 97%;Hexafluoroglutaric acid,97%;Perfluoroglutaric acid,Hexafluoroglutaric acid;Hexafluoroglutaric acid, 97% 5GR | | CAS: | 376-73-8 | | MF: | C5H2F6O4 | | MW: | 240.06 | | EINECS: | 206-813-9 | | Product Categories: | organofluorine compounds | | Mol File: | 376-73-8.mol |  |
| | HEXAFLUOROGLUTARIC ACID Chemical Properties |
| Melting point | 88-91 °C (lit.) | | Boiling point | 134-138 °C/3 mmHg (lit.) | | density | 1.6649 (estimate) | | Fp | 134-138°C/3mm | | storage temp. | Storage temp. 2-8°C | | pka | 0.23±0.10(Predicted) | | form | powder to crystal | | color | White to Brown to Dark purple | | Sensitive | Hygroscopic | | BRN | 1801049 | | Stability: | hygroscopic | | InChI | 1S/C5H2F6O4/c6-3(7,1(12)13)5(10,11)4(8,9)2(14)15/h(H,12,13)(H,14,15) | | InChIKey | CCUWGJDGLACFQT-UHFFFAOYSA-N | | SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(O)=O | | CAS DataBase Reference | 376-73-8(CAS DataBase Reference) | | EPA Substance Registry System | Pentanedioic acid, hexafluoro- (376-73-8) |
| Hazard Codes | C,Xi | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | F | 3 | | Hazard Note | Corrosive/Hygroscopic | | TSCA | TSCA listed | | HazardClass | IRRITANT, HYGROSCOPIC, CORROSIVE | | HazardClass | 8 | | HS Code | 29171900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | HEXAFLUOROGLUTARIC ACID Usage And Synthesis |
| Chemical Properties | almost white to light beige adhering cryst. powder |
| | HEXAFLUOROGLUTARIC ACID Preparation Products And Raw materials |
|