| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(Perfluoropropoxy)perfluoropropyl trifluorovinyl ether Basic information |
| Product Name: | 2-(Perfluoropropoxy)perfluoropropyl trifluorovinyl ether | | Synonyms: | perfluoropropoxyperfluoropropyltrifluorovinylether;PERFLUORO(5-METHYL-3,6-DIOXANON-1-ENE);1,1,1,2,3,3-hexafluoro-2-(heptafluoropropoxy)-3-[(trifluorovinyl)oxy]propane;2-(Perfluoropropoxy)perfluoropropyl trifluorovinyl;2-(PERFLUOROPROPOXY)PERFLUOROPROPYL TRIFLUOROVINYL ETHER 98+%;2-(Heptafluoropropoxy)hexafluoropropyl Trifluorovinyl Ether;1,1,1,2,2,3,3-Heptafluoro-3-({1,1,1,2,3,3-hexafluoro-3-[(trifluoroethenyl)oxy]prop-2-yl}oxy)propane, 2-(Heptafluoropropoxy)hexafluoropropyl trifluorovinyl ether;2-(Heptafluoropropoxy)hexafluoropropylTrifluorovinylEther> | | CAS: | 1644-11-7 | | MF: | C8F16O2 | | MW: | 432.06 | | EINECS: | 216-703-2 | | Product Categories: | | | Mol File: | 1644-11-7.mol |  |
| | 2-(Perfluoropropoxy)perfluoropropyl trifluorovinyl ether Chemical Properties |
| Boiling point | 104 °C | | density | 1.69 | | vapor pressure | 47-60hPa at 20-25℃ | | Fp | 52℃ | | storage temp. | Refrigerator | | form | Liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.8 | | InChI | InChI=1S/C8F16O2/c9-1(10)2(11)25-8(23,24)4(14,6(18,19)20)26-7(21,22)3(12,13)5(15,16)17 | | InChIKey | RJBJXVAPYONTFE-UHFFFAOYSA-N | | SMILES | C(OC(C(F)(F)O/C(/F)=C(\F)/F)(F)C(F)(F)F)(F)(F)C(F)(F)C(F)(F)F | | LogP | 6.2 at 25.7℃ | | CAS DataBase Reference | 1644-11-7(CAS DataBase Reference) | | EPA Substance Registry System | Perfluoro(2-propoxypropyl vinyl ether) (1644-11-7) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2932990090 |
| | 2-(Perfluoropropoxy)perfluoropropyl trifluorovinyl ether Usage And Synthesis |
| | 2-(Perfluoropropoxy)perfluoropropyl trifluorovinyl ether Preparation Products And Raw materials |
|