1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester manufacturers
|
| | 1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester Basic information |
| Product Name: | 1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester | | Synonyms: | 1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester;Ethyl 4-(2,2,2-trifluoroethoxy)-1H-pyrazole-3-carboxylate;ethyl 4-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-carboxylate | | CAS: | 2394876-74-3 | | MF: | C8H9F3N2O3 | | MW: | 238.16 | | EINECS: | | | Product Categories: | | | Mol File: | 2394876-74-3.mol |  |
| | 1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester Chemical Properties |
| Boiling point | 317.2±42.0 °C(Predicted) | | density | 1.382±0.06 g/cm3(Predicted) | | pka | 11.46±0.50(Predicted) | | InChI | InChI=1S/C8H9F3N2O3/c1-2-15-7(14)6-5(3-12-13-6)16-4-8(9,10)11/h3H,2,4H2,1H3,(H,12,13) | | InChIKey | BYFYFRIOBSJQSR-UHFFFAOYSA-N | | SMILES | N1C=C(OCC(F)(F)F)C(C(OCC)=O)=N1 |
| | 1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester Usage And Synthesis |
| | 1H-Pyrazole-3-carboxylic acid, 4-(2,2,2-trifluoroethoxy)-, ethyl ester Preparation Products And Raw materials |
|