| Company Name: |
Tianjin Derchemist Science & Technology Co., Ltd.
|
| Tel: |
22-58627059 13920586291 |
| Email: |
zdcomcon@126.com |
| Products Intro: |
Product Name:(S)-Methyl hexahydropyridazine-3-carboxylate
CAS:138323-07-6
Purity:98% Package:1g；5g；10g；25g；50g；100g；500g；1kg；5kg；10kg；25kg
|
| Company Name: |
Syncozymes (Shanghai) Co.,Ltd.
|
| Tel: |
021-68187180 13681683526 |
| Email: |
lchen@syncozymes.com |
| Products Intro: |
CAS:138323-07-6
Purity:99% Package:1kg;10kg;100kg
|
| Company Name: |
TaiChem Taizhou Limited
|
| Tel: |
052386810091 |
| Email: |
zcwy9518@yeah.net |
| Products Intro: |
Product Name:3-Pyridazinecarboxylicacid,hexahydro-,methylester,(3S)-(9CI)
CAS:138323-07-6
Purity:1g;5g;25g Remarks:95-97%
|
| Company Name: |
Shanghai Chaolan Chemical Technology Center
|
| Tel: |
021-QQ：65489617 15618227136 |
| Email: |
Sales@ATKchemical.com |
| Products Intro: |
Product Name:methyl (S)-hexahydropyridazine-3-carboxylate
CAS:138323-07-6
Purity:98 Package:1G,5G,10G,50G,100G,500G
|
|
| | (S)-methyl hexahydropyridazine-3-carboxylate Basic information |
| Product Name: | (S)-methyl hexahydropyridazine-3-carboxylate | | Synonyms: | 3-Pyridazinecarboxylicacid,hexahydro-,methylester,(3S)-(9CI);Hexahydropyridazine-3-carboxylic acid methyl ester;Hexahydropyridazine-3-carboxylic acid methyl ester trifluoroacetate salt;(3S)-1,2-Diazinane-3-carboxylic acid methyl ester;(3S)-1,2-Diazine-3-carboxylic acid methyl ester;3-Pyridazinecarboxylic acid, hexahydro-, methyl ester, (3S)-;methyl (3S)-1,2-diazinane-3-carboxylate;(S)-methyl hexahydropyridazine-3-carboxylate trifluoroacetate salt | | CAS: | 138323-07-6 | | MF: | C6H12N2O2 | | MW: | 144.17 | | EINECS: | | | Product Categories: | CARBOXYLICESTER;PYRIDAZINE | | Mol File: | 138323-07-6.mol |  |
| | (S)-methyl hexahydropyridazine-3-carboxylate Chemical Properties |
| Boiling point | 193.5±29.0 °C(Predicted) | | density | 1.059±0.06 g/cm3(Predicted) | | pka | 8.09±0.40(Predicted) | | InChI | InChI=1S/C6H12N2O2/c1-10-6(9)5-3-2-4-7-8-5/h5,7-8H,2-4H2,1H3/t5-/m0/s1 | | InChIKey | GAUFSAOOPHWSRO-YFKPBYRVSA-N | | SMILES | [C@H]1(C(OC)=O)NNCCC1 |
| | (S)-methyl hexahydropyridazine-3-carboxylate Usage And Synthesis |
| Uses | (S)-methyl hexahydropyridazine-3-carboxylate is used as a pharmaceutical intermediate compound for the preparation of Ras inhibitors for the treatment of cancer. |
| | (S)-methyl hexahydropyridazine-3-carboxylate Preparation Products And Raw materials |
|