|
|
| | 2,5-Pyridinedicarbonitrile(6CI,8CI,9CI) Basic information | | Uses |
| | 2,5-Pyridinedicarbonitrile(6CI,8CI,9CI) Chemical Properties |
| Melting point | 111-112 °C | | Boiling point | 110 °C(Press: 3 Torr) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | -3.77±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H3N3/c8-3-6-1-2-7(4-9)10-5-6/h1-2,5H | | InChIKey | YXHPFSCDWSLLRT-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=C(C#N)C=C1 |
| | 2,5-Pyridinedicarbonitrile(6CI,8CI,9CI) Usage And Synthesis |
| Uses | 2,5-Dicyanopyridine is a pyridine derivative that can be used as a pharmaceutical intermediate. |
| | 2,5-Pyridinedicarbonitrile(6CI,8CI,9CI) Preparation Products And Raw materials |
|