CGP 11130 manufacturers
- CGP 11130
-
- $1.00 / 1g
-
2024-05-12
- CAS:52237-19-1
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100kg
- CGP 11130
-
- $102.00 / 10kilograms
-
2024-05-10
- CAS:52237-19-1
- Min. Order: 10kilograms
- Purity: 99%
- Supply Ability: 100tons
|
| | CGP 11130 Basic information |
| Product Name: | CGP 11130 | | Synonyms: | CGP 11130;4-Amino-3-(4-fluorophenyl)butyric acid;β-(Aminomethyl)-4-fluorobenzenepropanoic acid;Benzenepropanoic acid, β-(aminomethyl)-4-fluoro-;4-Amino-3-(4-fluoro-phenyl)-butyric Acid
DISCONTINUED. Please see A608650.;F-Phenibut;4-Amino-3-(4-fluorophenyl)butanoic acid | | CAS: | 52237-19-1 | | MF: | C10H12FNO2 | | MW: | 197.21 | | EINECS: | 200-838-9 | | Product Categories: | Amino Acid | | Mol File: | 52237-19-1.mol |  |
| | CGP 11130 Chemical Properties |
| Boiling point | 329.1±32.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | pka | 4.08±0.10(Predicted) | | InChI | InChI=1S/C10H12FNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14) | | InChIKey | QWHXHLDNSXLAPX-UHFFFAOYSA-N | | SMILES | C(C1C=CC(F)=CC=1)(CN)CC(=O)O |
| | CGP 11130 Usage And Synthesis |
| | CGP 11130 Preparation Products And Raw materials |
|