| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tris(4-methoxy-3,5-dimethylphenyl)phosphine Basic information |
| Product Name: | Tris(4-methoxy-3,5-dimethylphenyl)phosphine | | Synonyms: | TRIS(3,5-DIMETHYL-4-METHOXY)PHOSPHINE;TRIS(4-METHOXY-3,5-DIMETHYLPHENYL)PHOSPHINE,MIN.98%;tris(4-methoxy-3,5-dimethylphenyl)phosphine,min.;Tris(4-methoxy-3,5-dimethylphenyl)phosphine, 98+%;Tris(4-methoxy-3,5-dimethylphenyl)phosphine 97%;Tris(4-methoxy-3,5-dimethylphenyl);TRIS(4-METOXY-3,5-DIMETHYLPHENYL)PHOSPHIN;tris(4-methoxy-3,5-dimethylphenyl)phosphane | | CAS: | 121898-64-4 | | MF: | C27H33O3P | | MW: | 436.52 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;organophosphine compound | | Mol File: | 121898-64-4.mol |  |
| | Tris(4-methoxy-3,5-dimethylphenyl)phosphine Chemical Properties |
| Melting point | 174-179 °C | | Boiling point | 539.3±50.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white | | InChI | 1S/C27H33O3P/c1-16-10-22(11-17(2)25(16)28-7)31(23-12-18(3)26(29-8)19(4)13-23)24-14-20(5)27(30-9)21(6)15-24/h10-15H,1-9H3 | | InChIKey | BDGUINGZRGNLPD-UHFFFAOYSA-N | | SMILES | COc1c(C)cc(cc1C)P(c2cc(C)c(OC)c(C)c2)c3cc(C)c(OC)c(C)c3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tris(4-methoxy-3,5-dimethylphenyl)phosphine Usage And Synthesis |
| Uses | Catalyst for carbocyanation of alkynes | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Tris(4-methoxy-3,5-dimethylphenyl)phosphine Preparation Products And Raw materials |
|