|
|
| | 1,2:5,6-Di-O-cyclohexylidene-D-mannitol Basic information |
| Product Name: | 1,2:5,6-Di-O-cyclohexylidene-D-mannitol | | Synonyms: | (1S,2S)-1,2-di((R)-1,4-dioxaspiro[4.5]decan-2-yl)ethane-1,2-diol;D-Mannitol, 1,2:5,6-di-O-cyclohexylidene-;1,2:5,6-Di-O-cyclohexylidene-D-mannitol;1,2:5,6-Di-O-cyclohexylidene-D-mannitol | | CAS: | 76779-67-4 | | MF: | C18H30O6 | | MW: | 342.43 | | EINECS: | | | Product Categories: | Carbohydrate Synthesis;Monosaccharides;Specialty Synthesis | | Mol File: | 76779-67-4.mol |  |
| | 1,2:5,6-Di-O-cyclohexylidene-D-mannitol Chemical Properties |
| Melting point | 103-105 °C(lit.) | | Boiling point | 525.9±40.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | pka | 12.99±0.20(Predicted) | | Optical Rotation | [α]20/D +5.8°, c = 3 in methylene chloride | | BRN | 4235336 | | InChI | 1S/C18H30O6/c19-15(13-11-21-17(23-13)7-3-1-4-8-17)16(20)14-12-22-18(24-14)9-5-2-6-10-18/h13-16,19-20H,1-12H2/t13-,14-,15-,16-/m1/s1 | | InChIKey | DFWHMBZZFDLOTN-KLHDSHLOSA-N | | SMILES | O[C@@H]([C@H](O)[C@H]1COC2(CCCCC2)O1)[C@H]3COC4(CCCCC4)O3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,2:5,6-Di-O-cyclohexylidene-D-mannitol Usage And Synthesis |
| | 1,2:5,6-Di-O-cyclohexylidene-D-mannitol Preparation Products And Raw materials |
|